C23H23FN4O4 — CID 55604819
N'-[4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)butanoyl]-2-fluorobenzohydrazide (PubChem CID 55604819) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is N'-[4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)butanoyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)butanoyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 55604819 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N'-[4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)butanoyl]-2-fluorobenzohydrazide |
| SMILES | CC12CCC(=O)N1c1ccccc1C(=O)N2CCCC(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C23H23FN4O4/c1-23-13-12-20(30)28(23)18-10-5-3-8-16(18)22(32)27(23)14-6-11-19(29)25-26-21(31)15-7-2-4-9-17(15)24/h2-5,7-10H,6,11-14H2,1H3,(H,25,29)(H,26,31) |
| InChIKey | YTKGXXCLUHXUCI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|