C21H24N2O4S — CID 55613156
3-(cyclopentylsulfamoyl)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)benzamide (PubChem CID 55613156) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55613156 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1Cc2ccccc2O1)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C21H24N2O4S/c24-21(22-14-18-12-15-6-1-4-11-20(15)27-18)16-7-5-10-19(13-16)28(25,26)23-17-8-2-3-9-17/h1,4-7,10-11,13,17-18,23H,2-3,8-9,12,14H2,(H,22,24) |
| InChIKey | UBSWEEUMIWTQRE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |