C24H30N6O2 — CID 55614160
4-tert-butyl-N-[3-methyl-1-[4-methyl-3-(tetrazol-1-yl)anilino]-1-oxobutan-2-yl]benzamide (PubChem CID 55614160) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-methyl-1-[4-methyl-3-(tetrazol-1-yl)anilino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-methyl-1-[4-methyl-3-(tetrazol-1-yl)anilino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55614160 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 4-tert-butyl-N-[3-methyl-1-[4-methyl-3-(tetrazol-1-yl)anilino]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)C(NC(=O)c2ccc(C(C)(C)C)cc2)C(C)C)cc1-n1cnnn1 |
| InChI | InChI=1S/C24H30N6O2/c1-15(2)21(27-22(31)17-8-10-18(11-9-17)24(4,5)6)23(32)26-19-12-7-16(3)20(13-19)30-14-25-28-29-30/h7-15,21H,1-6H3,(H,26,32)(H,27,31) |
| InChIKey | UAWZUHSJHFKPCC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |