C24H26N2O3S2 — CID 55614913
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide (PubChem CID 55614913) has the molecular formula C24H26N2O3S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55614913 |
| Molecular Formula | C24H26N2O3S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
| SMILES | Cc1nc(CSc2ccccc2C(=O)NCCOc2cccc3c2OC(C)(C)C3)cs1 |
| InChI | InChI=1S/C24H26N2O3S2/c1-16-26-18(14-30-16)15-31-21-10-5-4-8-19(21)23(27)25-11-12-28-20-9-6-7-17-13-24(2,3)29-22(17)20/h4-10,14H,11-13,15H2,1-3H3,(H,25,27) |
| InChIKey | RMLXYMDVJOGJKJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|