C21H21N3O3S — CID 55616245
(E)-N-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 55616245) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (E)-N-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55616245 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (E)-N-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCCC(=O)N1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H21N3O3S/c25-19(10-9-15-5-4-14-27-15)22-12-11-20(26)24-13-3-7-17(24)21-23-16-6-1-2-8-18(16)28-21/h1-2,4-6,8-10,14,17H,3,7,11-13H2,(H,22,25)/b10-9+ |
| InChIKey | TVXXFMRJEKOBCG-MDZDMXLPSA-N |
| XLogP | 3.77 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|