C19H20N6O2 — CID 55619412
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N'-(4-methoxypyrimidin-2-yl)prop-2-enehydrazide (PubChem CID 55619412) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N'-(4-methoxypyrimidin-2-yl)prop-2-enehydrazide.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N'-(4-methoxypyrimidin-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 55619412 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N'-(4-methoxypyrimidin-2-yl)prop-2-enehydrazide |
| SMILES | COc1ccnc(NNC(=O)/C=C/c2c(C)nn(-c3ccccc3)c2C)n1 |
| InChI | InChI=1S/C19H20N6O2/c1-13-16(14(2)25(24-13)15-7-5-4-6-8-15)9-10-17(26)22-23-19-20-12-11-18(21-19)27-3/h4-12H,1-3H3,(H,22,26)(H,20,21,23)/b10-9+ |
| InChIKey | KCOATTTUQSDJBC-MDZDMXLPSA-N |
| XLogP | 2.44 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|