C18H20N6O2S — CID 55619783
2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N'-(4-methoxypyrimidin-2-yl)acetohydrazide (PubChem CID 55619783) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N'-(4-methoxypyrimidin-2-yl)acetohydrazide.
| Compound Name | 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N'-(4-methoxypyrimidin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 55619783 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N'-(4-methoxypyrimidin-2-yl)acetohydrazide |
| SMILES | COc1ccnc(NNC(=O)CSc2nccn2-c2cc(C)ccc2C)n1 |
| InChI | InChI=1S/C18H20N6O2S/c1-12-4-5-13(2)14(10-12)24-9-8-20-18(24)27-11-15(25)22-23-17-19-7-6-16(21-17)26-3/h4-10H,11H2,1-3H3,(H,22,25)(H,19,21,23) |
| InChIKey | VWOLDIFOMZVFGY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|