C18H22F3N3O2S — CID 78861846
2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide (PubChem CID 78861846) has the molecular formula C18H22F3N3O2S and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide.
| Compound Name | 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 78861846 |
| Molecular Formula | C18H22F3N3O2S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
| SMILES | Cc1ccc(C)c(-n2ccnc2SCC(=O)NCCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H22F3N3O2S/c1-13-4-5-14(2)15(10-13)24-8-7-23-17(24)27-11-16(25)22-6-3-9-26-12-18(19,20)21/h4-5,7-8,10H,3,6,9,11-12H2,1-2H3,(H,22,25) |
| InChIKey | QWLNIWULZJGNGD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|