C16H28ClN3O2S — CID 55627118
1-chloro-2-[1-(dimethylamino)-2-(dipropylsulfamoylamino)ethyl]benzene (PubChem CID 55627118) has the molecular formula C16H28ClN3O2S and a molecular weight of 361.94 g/mol. Its IUPAC name is 1-chloro-2-[1-(dimethylamino)-2-(dipropylsulfamoylamino)ethyl]benzene.
| Compound Name | 1-chloro-2-[1-(dimethylamino)-2-(dipropylsulfamoylamino)ethyl]benzene |
|---|---|
| PubChem CID | 55627118 |
| Molecular Formula | C16H28ClN3O2S |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-chloro-2-[1-(dimethylamino)-2-(dipropylsulfamoylamino)ethyl]benzene |
| SMILES | CCCN(CCC)S(=O)(=O)NCC(c1ccccc1Cl)N(C)C |
| InChI | InChI=1S/C16H28ClN3O2S/c1-5-11-20(12-6-2)23(21,22)18-13-16(19(3)4)14-9-7-8-10-15(14)17/h7-10,16,18H,5-6,11-13H2,1-4H3 |
| InChIKey | XHMFEBMGXRSLHX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |