C26H41N3O4 — CID 55629214
1-butyl-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 55629214) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is 1-butyl-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | 1-butyl-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55629214 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 1-butyl-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CCCCN1C(=O)CCC(C(=O)NCCCN2CC(C)OC(C)C2)C1c1ccccc1OC |
| InChI | InChI=1S/C26H41N3O4/c1-5-6-16-29-24(30)13-12-22(25(29)21-10-7-8-11-23(21)32-4)26(31)27-14-9-15-28-17-19(2)33-20(3)18-28/h7-8,10-11,19-20,22,25H,5-6,9,12-18H2,1-4H3,(H,27,31) |
| InChIKey | WXUBIXOKWJPYSV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|