C26H39N3O4 — CID 94065116
(2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-(2-oxoazepan-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 94065116) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is (2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-(2-oxoazepan-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | (2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-(2-oxoazepan-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94065116 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | (2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-(2-oxoazepan-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CCCCN1C(=O)CC[C@H](C(=O)NCCCN2CCCCCC2=O)[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C26H39N3O4/c1-3-4-19-29-24(31)15-14-21(25(29)20-11-7-8-12-22(20)33-2)26(32)27-16-10-18-28-17-9-5-6-13-23(28)30/h7-8,11-12,21,25H,3-6,9-10,13-19H2,1-2H3,(H,27,32)/t21-,25-/m0/s1 |
| InChIKey | CXQITALUYCHKRJ-OFVILXPXSA-N |
| XLogP | 3.68 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|