C17H17BrN6O3S2 — CID 55630970
1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone (PubChem CID 55630970) has the molecular formula C17H17BrN6O3S2 and a molecular weight of 497.40 g/mol. Its IUPAC name is 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone.
| Compound Name | 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 55630970 |
| Molecular Formula | C17H17BrN6O3S2 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(-n2cnnn2)cc1)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C17H17BrN6O3S2/c18-15-5-6-17(28-15)29(26,27)23-9-7-22(8-10-23)16(25)11-13-1-3-14(4-2-13)24-12-19-20-21-24/h1-6,12H,7-11H2 |
| InChIKey | WLWCSJQXMRTIBK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |