C23H23N3O5S — CID 55631134
ethyl 2-methyl-6-[[3-[methyl(phenyl)sulfamoyl]phenyl]carbamoyl]pyridine-3-carboxylate (PubChem CID 55631134) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is ethyl 2-methyl-6-[[3-[methyl(phenyl)sulfamoyl]phenyl]carbamoyl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-methyl-6-[[3-[methyl(phenyl)sulfamoyl]phenyl]carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55631134 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | ethyl 2-methyl-6-[[3-[methyl(phenyl)sulfamoyl]phenyl]carbamoyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)Nc2cccc(S(=O)(=O)N(C)c3ccccc3)c2)nc1C |
| InChI | InChI=1S/C23H23N3O5S/c1-4-31-23(28)20-13-14-21(24-16(20)2)22(27)25-17-9-8-12-19(15-17)32(29,30)26(3)18-10-6-5-7-11-18/h5-15H,4H2,1-3H3,(H,25,27) |
| InChIKey | QBYATPDCAQAMED-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |