C21H20N2O4S — CID 55632813
3-[[3-(8-methoxy-3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 55632813) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-[[3-(8-methoxy-3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[3-(8-methoxy-3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 55632813 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-[[3-(8-methoxy-3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cccc2c1N(C(=O)c1cccc(CN3C(=O)CSC3=O)c1)CCC2 |
| InChI | InChI=1S/C21H20N2O4S/c1-27-17-9-3-6-15-8-4-10-22(19(15)17)20(25)16-7-2-5-14(11-16)12-23-18(24)13-28-21(23)26/h2-3,5-7,9,11H,4,8,10,12-13H2,1H3 |
| InChIKey | LIICBEIQFIUNBW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|