C19H21N3O6S — CID 55634611
(3-carbamoylphenyl)methyl 3-[(4-acetamidophenyl)sulfonylamino]propanoate (PubChem CID 55634611) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 3-[(4-acetamidophenyl)sulfonylamino]propanoate.
| Compound Name | (3-carbamoylphenyl)methyl 3-[(4-acetamidophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55634611 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (3-carbamoylphenyl)methyl 3-[(4-acetamidophenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)OCc2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C19H21N3O6S/c1-13(23)22-16-5-7-17(8-6-16)29(26,27)21-10-9-18(24)28-12-14-3-2-4-15(11-14)19(20)25/h2-8,11,21H,9-10,12H2,1H3,(H2,20,25)(H,22,23) |
| InChIKey | RSLPLMKFYZTMSI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |