C19H26N2O6S2 — CID 55639511
4-(2-methoxyethoxy)-N,3-dimethyl-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 55639511) has the molecular formula C19H26N2O6S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N,3-dimethyl-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-(2-methoxyethoxy)-N,3-dimethyl-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55639511 |
| Molecular Formula | C19H26N2O6S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-(2-methoxyethoxy)-N,3-dimethyl-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N(C)C(C)c2ccc(S(N)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C19H26N2O6S2/c1-14-13-18(9-10-19(14)27-12-11-26-4)29(24,25)21(3)15(2)16-5-7-17(8-6-16)28(20,22)23/h5-10,13,15H,11-12H2,1-4H3,(H2,20,22,23) |
| InChIKey | KKIVXTGTLBZNTN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|