C15H24N2O5S — CID 46417508
N'-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-3-methylbutanehydrazide (PubChem CID 46417508) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is N'-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-3-methylbutanehydrazide.
| Compound Name | N'-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 46417508 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N'-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-3-methylbutanehydrazide |
| SMILES | COCCOc1ccc(S(=O)(=O)NNC(=O)CC(C)C)cc1C |
| InChI | InChI=1S/C15H24N2O5S/c1-11(2)9-15(18)16-17-23(19,20)13-5-6-14(12(3)10-13)22-8-7-21-4/h5-6,10-11,17H,7-9H2,1-4H3,(H,16,18) |
| InChIKey | ZGRZEVDKOFGMMP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|