C20H20BrN3O5S — CID 55650758
3-[[(5-bromo-1-benzofuran-2-carbonyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 55650758) has the molecular formula C20H20BrN3O5S and a molecular weight of 494.37 g/mol. Its IUPAC name is 3-[[(5-bromo-1-benzofuran-2-carbonyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[[(5-bromo-1-benzofuran-2-carbonyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55650758 |
| Molecular Formula | C20H20BrN3O5S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 3-[[(5-bromo-1-benzofuran-2-carbonyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)c2cc3cc(Br)ccc3o2)c1 |
| InChI | InChI=1S/C20H20BrN3O5S/c1-3-24(4-2)30(27,28)16-7-5-6-13(11-16)19(25)22-23-20(26)18-12-14-10-15(21)8-9-17(14)29-18/h5-12H,3-4H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | GHOZVNWAZFDOAN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|