C19H22F2N2O5S — CID 55652582
N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide (PubChem CID 55652582) has the molecular formula C19H22F2N2O5S and a molecular weight of 428.46 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 55652582 |
| Molecular Formula | C19H22F2N2O5S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)NCC(O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H22F2N2O5S/c1-12-3-5-14(29(26,27)23-7-8-28-2)10-15(12)19(25)22-11-18(24)13-4-6-16(20)17(21)9-13/h3-6,9-10,18,23-24H,7-8,11H2,1-2H3,(H,22,25) |
| InChIKey | QMKGHWFBDVNYIA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|