C17H20N6O3S — CID 55653197
N-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 55653197) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 55653197 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(NC(=O)CCN2CCSC2=O)cc1)n1cncn1 |
| InChI | InChI=1S/C17H20N6O3S/c1-12(23-11-18-10-19-23)16(25)21-14-4-2-13(3-5-14)20-15(24)6-7-22-8-9-27-17(22)26/h2-5,10-12H,6-9H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | VKJXJPUAEVWCCH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|