C22H27N3O5 — CID 55653893
4-(cyclopropylamino)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-nitrobenzamide (PubChem CID 55653893) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55653893 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 4-(cyclopropylamino)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-nitrobenzamide |
| SMILES | COc1cc(C(C)NC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)ccc1OC(C)C |
| InChI | InChI=1S/C22H27N3O5/c1-13(2)30-20-10-6-15(12-21(20)29-4)14(3)23-22(26)16-5-9-18(24-17-7-8-17)19(11-16)25(27)28/h5-6,9-14,17,24H,7-8H2,1-4H3,(H,23,26) |
| InChIKey | DJRGKZBEHLKDSG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|