C22H36N4O4S — CID 55656769
N-[4-(4-methylpiperazin-1-yl)butyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 55656769) has the molecular formula C22H36N4O4S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)butyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)butyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55656769 |
| Molecular Formula | C22H36N4O4S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)butyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | CN1CCN(CCCCNC(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C22H36N4O4S/c1-24-12-14-25(15-13-24)11-3-2-10-23-22(27)9-6-20-4-7-21(8-5-20)31(28,29)26-16-18-30-19-17-26/h4-5,7-8H,2-3,6,9-19H2,1H3,(H,23,27) |
| InChIKey | LXGYMYZGSHYYON-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|