C19H28F3N3O4S — CID 55720364
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 55720364) has the molecular formula C19H28F3N3O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55720364 |
| Molecular Formula | C19H28F3N3O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | CN(CCCNC(=O)CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)CC(F)(F)F |
| InChI | InChI=1S/C19H28F3N3O4S/c1-24(15-19(20,21)22)10-2-9-23-18(26)8-5-16-3-6-17(7-4-16)30(27,28)25-11-13-29-14-12-25/h3-4,6-7H,2,5,8-15H2,1H3,(H,23,26) |
| InChIKey | PHWYJEKRNLWGPC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|