C22H29ClN4O3 — CID 55658723
N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55658723) has the molecular formula C22H29ClN4O3 and a molecular weight of 432.95 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55658723 |
| Molecular Formula | C22H29ClN4O3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)NCC(c1cccc(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C22H29ClN4O3/c23-17-8-6-7-16(13-17)18(26-11-4-5-12-26)14-24-19(28)15-27-20(29)22(25-21(27)30)9-2-1-3-10-22/h6-8,13,18H,1-5,9-12,14-15H2,(H,24,28)(H,25,30) |
| InChIKey | KZMMWYFXUGZOFN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|