C23H29BrN2O4 — CID 55660338
3-bromo-4-ethoxy-5-methoxy-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 55660338) has the molecular formula C23H29BrN2O4 and a molecular weight of 477.40 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-5-methoxy-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-5-methoxy-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 55660338 |
| Molecular Formula | C23H29BrN2O4 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-bromo-4-ethoxy-5-methoxy-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | CCOc1c(Br)cc(C(=O)NCC(c2cccc(C)c2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H29BrN2O4/c1-4-30-22-19(24)13-18(14-21(22)28-3)23(27)25-15-20(26-8-10-29-11-9-26)17-7-5-6-16(2)12-17/h5-7,12-14,20H,4,8-11,15H2,1-3H3,(H,25,27) |
| InChIKey | HWBRWFVMTZXWTC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |