C23H25NO4 — CID 55660922
2-(4-ethylphenoxy)-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]acetamide (PubChem CID 55660922) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55660922 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)NCc2cccc(COCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-2-18-8-10-21(11-9-18)28-17-23(25)24-14-19-5-3-6-20(13-19)15-26-16-22-7-4-12-27-22/h3-13H,2,14-17H2,1H3,(H,24,25) |
| InChIKey | BPXJMRSZAVCMLL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |