C21H23NO3S — CID 55660950
4-ethyl-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-5-methylthiophene-2-carboxamide (PubChem CID 55660950) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-ethyl-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-5-methylthiophene-2-carboxamide.
| Compound Name | 4-ethyl-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55660950 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-ethyl-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)NCc2cccc(COCc3ccco3)c2)sc1C |
| InChI | InChI=1S/C21H23NO3S/c1-3-18-11-20(26-15(18)2)21(23)22-12-16-6-4-7-17(10-16)13-24-14-19-8-5-9-25-19/h4-11H,3,12-14H2,1-2H3,(H,22,23) |
| InChIKey | MPPHWARVWUXHAE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |