C27H37N5O3 — CID 55662691
N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 55662691) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55662691 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCC(C)NC(=O)C3CCN(c4ccccc4[N+](=O)[O-])CC3)CC2)c1 |
| InChI | InChI=1S/C27H37N5O3/c1-21-6-5-7-24(20-21)30-18-16-29(17-19-30)13-10-22(2)28-27(33)23-11-14-31(15-12-23)25-8-3-4-9-26(25)32(34)35/h3-9,20,22-23H,10-19H2,1-2H3,(H,28,33) |
| InChIKey | YICKMMYPNAGUFS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|