C21H27ClN4O4S — CID 55682100
4-chloro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 55682100) has the molecular formula C21H27ClN4O4S and a molecular weight of 466.99 g/mol. Its IUPAC name is 4-chloro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55682100 |
| Molecular Formula | C21H27ClN4O4S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-chloro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1cccc(N2CCN(CCC(C)NS(=O)(=O)c3ccc(Cl)cc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C21H27ClN4O4S/c1-16-4-3-5-19(14-16)25-12-10-24(11-13-25)9-8-17(2)23-31(29,30)21-7-6-18(22)15-20(21)26(27)28/h3-7,14-15,17,23H,8-13H2,1-2H3 |
| InChIKey | LLNFGUJFKMKKNS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|