C23H33N5O4S — CID 38795057
N,N-diethyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethylamino]-3-nitrobenzenesulfonamide (PubChem CID 38795057) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is N,N-diethyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethylamino]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 38795057 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N,N-diethyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethylamino]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCCN2CCN(c3cccc(C)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H33N5O4S/c1-4-27(5-2)33(31,32)21-9-10-22(23(18-21)28(29)30)24-11-12-25-13-15-26(16-14-25)20-8-6-7-19(3)17-20/h6-10,17-18,24H,4-5,11-16H2,1-3H3 |
| InChIKey | MTCPNEQLWZPYAJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|