C20H29N5O6S — CID 26441552
4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propylamino]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 26441552) has the molecular formula C20H29N5O6S and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propylamino]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propylamino]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26441552 |
| Molecular Formula | C20H29N5O6S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propylamino]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCCCN2C(=O)NC3(CCCC3)C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H29N5O6S/c1-3-23(4-2)32(30,31)15-8-9-16(17(14-15)25(28)29)21-12-7-13-24-18(26)20(22-19(24)27)10-5-6-11-20/h8-9,14,21H,3-7,10-13H2,1-2H3,(H,22,27) |
| InChIKey | YEWPMVSLRDKGPE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|