C19H33N4O4S+ — CID 9181545
[1-[[4-(diethylsulfamoyl)-2-nitroanilino]methyl]cyclohexyl]-dimethylazanium (PubChem CID 9181545) has the molecular formula C19H33N4O4S+ and a molecular weight of 413.56 g/mol. Its IUPAC name is [1-[[4-(diethylsulfamoyl)-2-nitroanilino]methyl]cyclohexyl]-dimethylazanium.
| Compound Name | [1-[[4-(diethylsulfamoyl)-2-nitroanilino]methyl]cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 9181545 |
| Molecular Formula | C19H33N4O4S+ |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [1-[[4-(diethylsulfamoyl)-2-nitroanilino]methyl]cyclohexyl]-dimethylazanium |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCC2([NH+](C)C)CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H32N4O4S/c1-5-22(6-2)28(26,27)16-10-11-17(18(14-16)23(24)25)20-15-19(21(3)4)12-8-7-9-13-19/h10-11,14,20H,5-9,12-13,15H2,1-4H3/p+1 |
| InChIKey | SBSORYUWZUYRFC-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|