C21H21N3O3S — CID 55669637
4-[3-(2,4-dimethylphenoxy)propanoylamino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 55669637) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-[3-(2,4-dimethylphenoxy)propanoylamino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[3-(2,4-dimethylphenoxy)propanoylamino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55669637 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-[3-(2,4-dimethylphenoxy)propanoylamino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1ccc(OCCC(=O)Nc2ccc(C(=O)Nc3nccs3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H21N3O3S/c1-14-3-8-18(15(2)13-14)27-11-9-19(25)23-17-6-4-16(5-7-17)20(26)24-21-22-10-12-28-21/h3-8,10,12-13H,9,11H2,1-2H3,(H,23,25)(H,22,24,26) |
| InChIKey | JTQBNQIPPNQVOA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |