C19H19BrN2O2S — CID 55672612
(E)-3-(5-bromothiophen-2-yl)-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 55672612) has the molecular formula C19H19BrN2O2S and a molecular weight of 419.34 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55672612 |
| Molecular Formula | C19H19BrN2O2S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | Cc1cccc(C(=O)N2CCCC2)c1NC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C19H19BrN2O2S/c1-13-5-4-6-15(19(24)22-11-2-3-12-22)18(13)21-17(23)10-8-14-7-9-16(20)25-14/h4-10H,2-3,11-12H2,1H3,(H,21,23)/b10-8+ |
| InChIKey | NFPIJRYMLBEIES-CSKARUKUSA-N |
| XLogP | 4.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|