C20H27N5O4S — CID 55674641
4-(4-acetylpiperazin-1-yl)sulfonyl-N-(2-butylpyrazol-3-yl)benzamide (PubChem CID 55674641) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)sulfonyl-N-(2-butylpyrazol-3-yl)benzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)sulfonyl-N-(2-butylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 55674641 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)sulfonyl-N-(2-butylpyrazol-3-yl)benzamide |
| SMILES | CCCCn1nccc1NC(=O)c1ccc(S(=O)(=O)N2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C20H27N5O4S/c1-3-4-11-25-19(9-10-21-25)22-20(27)17-5-7-18(8-6-17)30(28,29)24-14-12-23(13-15-24)16(2)26/h5-10H,3-4,11-15H2,1-2H3,(H,22,27) |
| InChIKey | YMCZMJLGUXNXSU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |