C22H29N3O3 — CID 55677594
8-ethyl-3-[2-(4-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 55677594) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 8-ethyl-3-[2-(4-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-ethyl-3-[2-(4-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 55677594 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 8-ethyl-3-[2-(4-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1CCC(C)c3ccccc31)C2=O |
| InChI | InChI=1S/C22H29N3O3/c1-3-16-8-11-22(12-9-16)20(27)25(21(28)23-22)14-19(26)24-13-10-15(2)17-6-4-5-7-18(17)24/h4-7,15-16H,3,8-14H2,1-2H3,(H,23,28) |
| InChIKey | MARMDRXLWCVHCD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|