C19H29N3O5 — CID 122114907
(2S,3S)-1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-methylpiperidine-3-carboxylic acid (PubChem CID 122114907) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S,3S)-1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-methylpiperidine-3-carboxylic acid.
| Compound Name | (2S,3S)-1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122114907 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (2S,3S)-1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-methylpiperidine-3-carboxylic acid |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1CCC[C@H](C(=O)O)[C@@H]1C)C2=O |
| InChI | InChI=1S/C19H29N3O5/c1-3-13-6-8-19(9-7-13)17(26)22(18(27)20-19)11-15(23)21-10-4-5-14(12(21)2)16(24)25/h12-14H,3-11H2,1-2H3,(H,20,27)(H,24,25)/t12-,13?,14-,19?/m0/s1 |
| InChIKey | HJUXYLUYAUXEDA-PNBPBRNGSA-N |
| XLogP | 1.59 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|