C22H33N3O5 — CID 154751077
8-ethyl-3-[2-oxo-2-[3-(2-oxocyclohexyl)morpholin-4-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 154751077) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is 8-ethyl-3-[2-oxo-2-[3-(2-oxocyclohexyl)morpholin-4-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-ethyl-3-[2-oxo-2-[3-(2-oxocyclohexyl)morpholin-4-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 154751077 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 8-ethyl-3-[2-oxo-2-[3-(2-oxocyclohexyl)morpholin-4-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1CCOCC1C1CCCCC1=O)C2=O |
| InChI | InChI=1S/C22H33N3O5/c1-2-15-7-9-22(10-8-15)20(28)25(21(29)23-22)13-19(27)24-11-12-30-14-17(24)16-5-3-4-6-18(16)26/h15-17H,2-14H2,1H3,(H,23,29) |
| InChIKey | QNFYDZPXXFNWOW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|