C22H23ClN6O3 — CID 55677679
methyl 2-(2-chlorophenyl)-2-[4-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperazin-1-yl]acetate (PubChem CID 55677679) has the molecular formula C22H23ClN6O3 and a molecular weight of 454.92 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[4-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[4-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 55677679 |
| Molecular Formula | C22H23ClN6O3 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[4-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCN(C(=O)Cc2ccc(-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C22H23ClN6O3/c1-32-22(31)21(18-4-2-3-5-19(18)23)28-12-10-27(11-13-28)20(30)14-16-6-8-17(9-7-16)29-15-24-25-26-29/h2-9,15,21H,10-14H2,1H3 |
| InChIKey | LXWJWZYMRXAPAK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |