C21H21ClN4O2 — CID 95735599
methyl (2S)-2-(2-chlorophenyl)-2-(4-phthalazin-1-ylpiperazin-1-yl)acetate (PubChem CID 95735599) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is methyl (2S)-2-(2-chlorophenyl)-2-(4-phthalazin-1-ylpiperazin-1-yl)acetate.
| Compound Name | methyl (2S)-2-(2-chlorophenyl)-2-(4-phthalazin-1-ylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 95735599 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-(4-phthalazin-1-ylpiperazin-1-yl)acetate |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCN(c2nncc3ccccc23)CC1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-28-21(27)19(17-8-4-5-9-18(17)22)25-10-12-26(13-11-25)20-16-7-3-2-6-15(16)14-23-24-20/h2-9,14,19H,10-13H2,1H3/t19-/m0/s1 |
| InChIKey | OKIOGTMBIWQQFZ-IBGZPJMESA-N |
| XLogP | 3.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |