C26H31N3O5S — CID 55678676
N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 55678676) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 55678676 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc3c4c([nH]c23)CCC(C)C4)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H31N3O5S/c1-3-34-23-10-8-18(16-24(23)35(31,32)29-11-13-33-14-12-29)27-26(30)20-6-4-5-19-21-15-17(2)7-9-22(21)28-25(19)20/h4-6,8,10,16-17,28H,3,7,9,11-15H2,1-2H3,(H,27,30) |
| InChIKey | LKWQSKCZKAFRIA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|