C20H22F2N2O4S — CID 55679628
(E)-N-[1-[2-(difluoromethoxy)phenyl]propyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55679628) has the molecular formula C20H22F2N2O4S and a molecular weight of 424.47 g/mol. Its IUPAC name is (E)-N-[1-[2-(difluoromethoxy)phenyl]propyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-[2-(difluoromethoxy)phenyl]propyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55679628 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (E)-N-[1-[2-(difluoromethoxy)phenyl]propyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCC(NC(=O)/C=C/c1ccc(S(=O)(=O)NC)cc1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H22F2N2O4S/c1-3-17(16-6-4-5-7-18(16)28-20(21)22)24-19(25)13-10-14-8-11-15(12-9-14)29(26,27)23-2/h4-13,17,20,23H,3H2,1-2H3,(H,24,25)/b13-10+ |
| InChIKey | CQTUFESMESRIAW-JLHYYAGUSA-N |
| XLogP | 3.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|