C21H24F2N2O5S — CID 55962692
3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]prop-2-enamide (PubChem CID 55962692) has the molecular formula C21H24F2N2O5S and a molecular weight of 454.50 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55962692 |
| Molecular Formula | C21H24F2N2O5S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]prop-2-enamide |
| SMILES | CCOc1cc(C=CC(=O)NC(C)c2ccccc2NS(C)(=O)=O)ccc1OC(F)F |
| InChI | InChI=1S/C21H24F2N2O5S/c1-4-29-19-13-15(9-11-18(19)30-21(22)23)10-12-20(26)24-14(2)16-7-5-6-8-17(16)25-31(3,27)28/h5-14,21,25H,4H2,1-3H3,(H,24,26) |
| InChIKey | ABXYZAOYWAROSB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|