C20H25FN4O3S — CID 55680100
N-ethyl-N-[(3-fluorophenyl)methyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 55680100) has the molecular formula C20H25FN4O3S and a molecular weight of 420.51 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 55680100 |
| Molecular Formula | C20H25FN4O3S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)CN1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C20H25FN4O3S/c1-2-24(15-17-5-3-6-18(21)13-17)20(26)16-23-9-11-25(12-10-23)29(27,28)19-7-4-8-22-14-19/h3-8,13-14H,2,9-12,15-16H2,1H3 |
| InChIKey | DHFPFUXWYHDSIN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |