C19H31NO3S — CID 55686789
N-[(3-ethoxy-4-propoxyphenyl)methyl]-2-methylsulfanyl-N-propylpropanamide (PubChem CID 55686789) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is N-[(3-ethoxy-4-propoxyphenyl)methyl]-2-methylsulfanyl-N-propylpropanamide.
| Compound Name | N-[(3-ethoxy-4-propoxyphenyl)methyl]-2-methylsulfanyl-N-propylpropanamide |
|---|---|
| PubChem CID | 55686789 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[(3-ethoxy-4-propoxyphenyl)methyl]-2-methylsulfanyl-N-propylpropanamide |
| SMILES | CCCOc1ccc(CN(CCC)C(=O)C(C)SC)cc1OCC |
| InChI | InChI=1S/C19H31NO3S/c1-6-11-20(19(21)15(4)24-5)14-16-9-10-17(23-12-7-2)18(13-16)22-8-3/h9-10,13,15H,6-8,11-12,14H2,1-5H3 |
| InChIKey | JMUXTXNDNNYZHT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |