C16H17FN2O4S — CID 55689394
3-fluoro-N,4-dimethyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide (PubChem CID 55689394) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-fluoro-N,4-dimethyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N,4-dimethyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55689394 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-fluoro-N,4-dimethyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C(C)c2cccc([N+](=O)[O-])c2)cc1F |
| InChI | InChI=1S/C16H17FN2O4S/c1-11-7-8-15(10-16(11)17)24(22,23)18(3)12(2)13-5-4-6-14(9-13)19(20)21/h4-10,12H,1-3H3 |
| InChIKey | ODSDGRAOHGSGQP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|