C13H19ClN2O4S — CID 107858848
3-chloro-N,2-dimethyl-N-[1-(3-nitrophenyl)ethyl]propane-1-sulfonamide (PubChem CID 107858848) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-[1-(3-nitrophenyl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-[1-(3-nitrophenyl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 107858848 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-[1-(3-nitrophenyl)ethyl]propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)N(C)C(C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19ClN2O4S/c1-10(8-14)9-21(19,20)15(3)11(2)12-5-4-6-13(7-12)16(17)18/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | QRUDDGDIOGRLJY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|