C19H24N2O6S — CID 24525717
3,4-diethoxy-N-methyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide (PubChem CID 24525717) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3,4-diethoxy-N-methyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-methyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24525717 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3,4-diethoxy-N-methyl-N-[1-(3-nitrophenyl)ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)C(C)c2cccc([N+](=O)[O-])c2)cc1OCC |
| InChI | InChI=1S/C19H24N2O6S/c1-5-26-18-11-10-17(13-19(18)27-6-2)28(24,25)20(4)14(3)15-8-7-9-16(12-15)21(22)23/h7-14H,5-6H2,1-4H3 |
| InChIKey | CKOQIUBNJULETJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|