C16H31N3O5S — CID 55694270
ethyl N-[3-methyl-1-oxo-1-[(1-propylsulfonylpiperidin-4-yl)amino]butan-2-yl]carbamate (PubChem CID 55694270) has the molecular formula C16H31N3O5S and a molecular weight of 377.51 g/mol. Its IUPAC name is ethyl N-[3-methyl-1-oxo-1-[(1-propylsulfonylpiperidin-4-yl)amino]butan-2-yl]carbamate.
| Compound Name | ethyl N-[3-methyl-1-oxo-1-[(1-propylsulfonylpiperidin-4-yl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 55694270 |
| Molecular Formula | C16H31N3O5S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl N-[3-methyl-1-oxo-1-[(1-propylsulfonylpiperidin-4-yl)amino]butan-2-yl]carbamate |
| SMILES | CCCS(=O)(=O)N1CCC(NC(=O)C(NC(=O)OCC)C(C)C)CC1 |
| InChI | InChI=1S/C16H31N3O5S/c1-5-11-25(22,23)19-9-7-13(8-10-19)17-15(20)14(12(3)4)18-16(21)24-6-2/h12-14H,5-11H2,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | LRSHMINHZZUXLG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |