C18H20IN3O2 — CID 55697019
N-(2,6-dimethylphenyl)-2-[(2-iodophenyl)carbamoyl-methylamino]acetamide (PubChem CID 55697019) has the molecular formula C18H20IN3O2 and a molecular weight of 437.28 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(2-iodophenyl)carbamoyl-methylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(2-iodophenyl)carbamoyl-methylamino]acetamide |
|---|---|
| PubChem CID | 55697019 |
| Molecular Formula | C18H20IN3O2 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(2-iodophenyl)carbamoyl-methylamino]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)Nc1ccccc1I |
| InChI | InChI=1S/C18H20IN3O2/c1-12-7-6-8-13(2)17(12)21-16(23)11-22(3)18(24)20-15-10-5-4-9-14(15)19/h4-10H,11H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | XZNUQDLQXFKMGX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|